C28H40FNO4 — CID 143558324
ethane;3-[1-[3-fluoro-2-(3-methoxy-5-methylphenyl)phenyl]-1-hydroxy-5-methoxypentyl]piperidine-1-carbaldehyde (PubChem CID 143558324) has the molecular formula C28H40FNO4 and a molecular weight of 473.63 g/mol. Its IUPAC name is ethane;3-[1-[3-fluoro-2-(3-methoxy-5-methylphenyl)phenyl]-1-hydroxy-5-methoxypentyl]piperidine-1-carbaldehyde.
| Compound Name | ethane;3-[1-[3-fluoro-2-(3-methoxy-5-methylphenyl)phenyl]-1-hydroxy-5-methoxypentyl]piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 143558324 |
| Molecular Formula | C28H40FNO4 |
| Molecular Weight | 473.63 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | ethane;3-[1-[3-fluoro-2-(3-methoxy-5-methylphenyl)phenyl]-1-hydroxy-5-methoxypentyl]piperidine-1-carbaldehyde |
| SMILES | CC.COCCCCC(O)(c1cccc(F)c1-c1cc(C)cc(OC)c1)C1CCCN(C=O)C1 |
| InChI | InChI=1S/C26H34FNO4.C2H6/c1-19-14-20(16-22(15-19)32-3)25-23(9-6-10-24(25)27)26(30,11-4-5-13-31-2)21-8-7-12-28(17-21)18-29;1-2/h6,9-10,14-16,18,21,30H,4-5,7-8,11-13,17H2,1-3H3;1-2H3 |
| InChIKey | XFEUZZHSROZCLM-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.63 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|