C27H36FNO4 — CID 145491038
1-[(3R)-3-[(1S)-1-[3-fluoro-2-(3-methoxy-5-methylphenyl)phenyl]-1-hydroxy-5-methoxypentyl]piperidin-1-yl]ethanone (PubChem CID 145491038) has the molecular formula C27H36FNO4 and a molecular weight of 457.59 g/mol. Its IUPAC name is 1-[(3R)-3-[(1S)-1-[3-fluoro-2-(3-methoxy-5-methylphenyl)phenyl]-1-hydroxy-5-methoxypentyl]piperidin-1-yl]ethanone.
| Compound Name | 1-[(3R)-3-[(1S)-1-[3-fluoro-2-(3-methoxy-5-methylphenyl)phenyl]-1-hydroxy-5-methoxypentyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 145491038 |
| Molecular Formula | C27H36FNO4 |
| Molecular Weight | 457.59 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | 1-[(3R)-3-[(1S)-1-[3-fluoro-2-(3-methoxy-5-methylphenyl)phenyl]-1-hydroxy-5-methoxypentyl]piperidin-1-yl]ethanone |
| SMILES | COCCCC[C@@](O)(c1cccc(F)c1-c1cc(C)cc(OC)c1)[C@@H]1CCCN(C(C)=O)C1 |
| InChI | InChI=1S/C27H36FNO4/c1-19-15-21(17-23(16-19)33-4)26-24(10-7-11-25(26)28)27(31,12-5-6-14-32-3)22-9-8-13-29(18-22)20(2)30/h7,10-11,15-17,22,31H,5-6,8-9,12-14,18H2,1-4H3/t22-,27+/m1/s1 |
| InChIKey | IPZLBFVHKCSTPG-AMGIVPHBSA-N |
| XLogP | 5.07 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.59 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|