C25H33FN2O4 — CID 71164134
methyl N-[(4S)-4-[3-fluoro-2-(3-methoxy-5-methylphenyl)phenyl]-4-hydroxy-4-[(3R)-piperidin-3-yl]butyl]carbamate (PubChem CID 71164134) has the molecular formula C25H33FN2O4 and a molecular weight of 444.55 g/mol. Its IUPAC name is methyl N-[(4S)-4-[3-fluoro-2-(3-methoxy-5-methylphenyl)phenyl]-4-hydroxy-4-[(3R)-piperidin-3-yl]butyl]carbamate.
| Compound Name | methyl N-[(4S)-4-[3-fluoro-2-(3-methoxy-5-methylphenyl)phenyl]-4-hydroxy-4-[(3R)-piperidin-3-yl]butyl]carbamate |
|---|---|
| PubChem CID | 71164134 |
| Molecular Formula | C25H33FN2O4 |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | methyl N-[(4S)-4-[3-fluoro-2-(3-methoxy-5-methylphenyl)phenyl]-4-hydroxy-4-[(3R)-piperidin-3-yl]butyl]carbamate |
| SMILES | COC(=O)NCCC[C@@](O)(c1cccc(F)c1-c1cc(C)cc(OC)c1)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C25H33FN2O4/c1-17-13-18(15-20(14-17)31-2)23-21(8-4-9-22(23)26)25(30,19-7-5-11-27-16-19)10-6-12-28-24(29)32-3/h4,8-9,13-15,19,27,30H,5-7,10-12,16H2,1-3H3,(H,28,29)/t19-,25+/m1/s1 |
| InChIKey | SCBLHUMYWDKDCS-CLOONOSVSA-N |
| XLogP | 4.13 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|