C24H31FN2O4 — CID 91367127
methyl N-[(4S)-4-[3-fluoro-2-(3-methoxyphenyl)phenyl]-4-hydroxy-4-[(3R)-piperidin-3-yl]butyl]carbamate (PubChem CID 91367127) has the molecular formula C24H31FN2O4 and a molecular weight of 430.52 g/mol. Its IUPAC name is methyl N-[(4S)-4-[3-fluoro-2-(3-methoxyphenyl)phenyl]-4-hydroxy-4-[(3R)-piperidin-3-yl]butyl]carbamate.
| Compound Name | methyl N-[(4S)-4-[3-fluoro-2-(3-methoxyphenyl)phenyl]-4-hydroxy-4-[(3R)-piperidin-3-yl]butyl]carbamate |
|---|---|
| PubChem CID | 91367127 |
| Molecular Formula | C24H31FN2O4 |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | methyl N-[(4S)-4-[3-fluoro-2-(3-methoxyphenyl)phenyl]-4-hydroxy-4-[(3R)-piperidin-3-yl]butyl]carbamate |
| SMILES | COC(=O)NCCC[C@@](O)(c1cccc(F)c1-c1cccc(OC)c1)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C24H31FN2O4/c1-30-19-9-3-7-17(15-19)22-20(10-4-11-21(22)25)24(29,18-8-5-13-26-16-18)12-6-14-27-23(28)31-2/h3-4,7,9-11,15,18,26,29H,5-6,8,12-14,16H2,1-2H3,(H,27,28)/t18-,24+/m1/s1 |
| InChIKey | PXUVDBLGZJXKRQ-KOSHJBKYSA-N |
| XLogP | 3.82 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|