C23H29ClN2O4 — CID 68989123
[4-[3-chloro-2-(3-methoxyphenyl)phenyl]-4-hydroxy-4-piperidin-3-ylbutyl]carbamic acid (PubChem CID 68989123) has the molecular formula C23H29ClN2O4 and a molecular weight of 432.95 g/mol. Its IUPAC name is [4-[3-chloro-2-(3-methoxyphenyl)phenyl]-4-hydroxy-4-piperidin-3-ylbutyl]carbamic acid.
| Compound Name | [4-[3-chloro-2-(3-methoxyphenyl)phenyl]-4-hydroxy-4-piperidin-3-ylbutyl]carbamic acid |
|---|---|
| PubChem CID | 68989123 |
| Molecular Formula | C23H29ClN2O4 |
| Molecular Weight | 432.95 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | [4-[3-chloro-2-(3-methoxyphenyl)phenyl]-4-hydroxy-4-piperidin-3-ylbutyl]carbamic acid |
| SMILES | COc1cccc(-c2c(Cl)cccc2C(O)(CCCNC(=O)O)C2CCCNC2)c1 |
| InChI | InChI=1S/C23H29ClN2O4/c1-30-18-8-2-6-16(14-18)21-19(9-3-10-20(21)24)23(29,11-5-13-26-22(27)28)17-7-4-12-25-15-17/h2-3,6,8-10,14,17,25-26,29H,4-5,7,11-13,15H2,1H3,(H,27,28) |
| InChIKey | UWDLFPYUNGEJFG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.95 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|