C25H30ClF3N2O2 — CID 76641043
N-[4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxy-4-piperidin-3-ylbutyl]-2,2,2-trifluoroacetamide (PubChem CID 76641043) has the molecular formula C25H30ClF3N2O2 and a molecular weight of 482.97 g/mol. Its IUPAC name is N-[4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxy-4-piperidin-3-ylbutyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxy-4-piperidin-3-ylbutyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 76641043 |
| Molecular Formula | C25H30ClF3N2O2 |
| Molecular Weight | 482.97 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | N-[4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxy-4-piperidin-3-ylbutyl]-2,2,2-trifluoroacetamide |
| SMILES | CCc1cccc(-c2c(Cl)cccc2C(O)(CCCNC(=O)C(F)(F)F)C2CCCNC2)c1 |
| InChI | InChI=1S/C25H30ClF3N2O2/c1-2-17-7-3-8-18(15-17)22-20(10-4-11-21(22)26)24(33,19-9-5-13-30-16-19)12-6-14-31-23(32)25(27,28)29/h3-4,7-8,10-11,15,19,30,33H,2,5-6,9,12-14,16H2,1H3,(H,31,32) |
| InChIKey | YHFZHSSGQLYDOQ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.97 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|