C33H37ClN2O6 — CID 68517482
4-[3-[1-[3-chloro-2-(3-ethylphenyl)phenyl]-1-hydroxy-4-(methoxycarbonylamino)butyl]piperidine-1-carbonyl]benzoic acid (PubChem CID 68517482) has the molecular formula C33H37ClN2O6 and a molecular weight of 593.12 g/mol. Its IUPAC name is 4-[3-[1-[3-chloro-2-(3-ethylphenyl)phenyl]-1-hydroxy-4-(methoxycarbonylamino)butyl]piperidine-1-carbonyl]benzoic acid.
| Compound Name | 4-[3-[1-[3-chloro-2-(3-ethylphenyl)phenyl]-1-hydroxy-4-(methoxycarbonylamino)butyl]piperidine-1-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 68517482 |
| Molecular Formula | C33H37ClN2O6 |
| Molecular Weight | 593.12 g/mol |
| Exact Mass | 592.23 |
| IUPAC Name | 4-[3-[1-[3-chloro-2-(3-ethylphenyl)phenyl]-1-hydroxy-4-(methoxycarbonylamino)butyl]piperidine-1-carbonyl]benzoic acid |
| SMILES | CCc1cccc(-c2c(Cl)cccc2C(O)(CCCNC(=O)OC)C2CCCN(C(=O)c3ccc(C(=O)O)cc3)C2)c1 |
| InChI | InChI=1S/C33H37ClN2O6/c1-3-22-8-4-9-25(20-22)29-27(11-5-12-28(29)34)33(41,17-7-18-35-32(40)42-2)26-10-6-19-36(21-26)30(37)23-13-15-24(16-14-23)31(38)39/h4-5,8-9,11-16,20,26,41H,3,6-7,10,17-19,21H2,1-2H3,(H,35,40)(H,38,39) |
| InChIKey | IMDZGCKYFBYPQQ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.12 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|