C33H39ClFN3O4 — CID 68516145
methyl N-[4-[1-[4-(aminomethyl)-2-fluorobenzoyl]piperidin-3-yl]-4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxybutyl]carbamate (PubChem CID 68516145) has the molecular formula C33H39ClFN3O4 and a molecular weight of 596.14 g/mol. Its IUPAC name is methyl N-[4-[1-[4-(aminomethyl)-2-fluorobenzoyl]piperidin-3-yl]-4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxybutyl]carbamate.
| Compound Name | methyl N-[4-[1-[4-(aminomethyl)-2-fluorobenzoyl]piperidin-3-yl]-4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxybutyl]carbamate |
|---|---|
| PubChem CID | 68516145 |
| Molecular Formula | C33H39ClFN3O4 |
| Molecular Weight | 596.14 g/mol |
| Exact Mass | 595.26 |
| IUPAC Name | methyl N-[4-[1-[4-(aminomethyl)-2-fluorobenzoyl]piperidin-3-yl]-4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxybutyl]carbamate |
| SMILES | CCc1cccc(-c2c(Cl)cccc2C(O)(CCCNC(=O)OC)C2CCCN(C(=O)c3ccc(CN)cc3F)C2)c1 |
| InChI | InChI=1S/C33H39ClFN3O4/c1-3-22-8-4-9-24(18-22)30-27(11-5-12-28(30)34)33(41,15-7-16-37-32(40)42-2)25-10-6-17-38(21-25)31(39)26-14-13-23(20-36)19-29(26)35/h4-5,8-9,11-14,18-19,25,41H,3,6-7,10,15-17,20-21,36H2,1-2H3,(H,37,40) |
| InChIKey | UFPQXFPUQQXHKG-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.14 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|