C33H40ClN3O4 — CID 68517662
methyl N-[4-[1-[4-(aminomethyl)benzoyl]piperidin-3-yl]-4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxybutyl]carbamate (PubChem CID 68517662) has the molecular formula C33H40ClN3O4 and a molecular weight of 578.15 g/mol. Its IUPAC name is methyl N-[4-[1-[4-(aminomethyl)benzoyl]piperidin-3-yl]-4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxybutyl]carbamate.
| Compound Name | methyl N-[4-[1-[4-(aminomethyl)benzoyl]piperidin-3-yl]-4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxybutyl]carbamate |
|---|---|
| PubChem CID | 68517662 |
| Molecular Formula | C33H40ClN3O4 |
| Molecular Weight | 578.15 g/mol |
| Exact Mass | 577.27 |
| IUPAC Name | methyl N-[4-[1-[4-(aminomethyl)benzoyl]piperidin-3-yl]-4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxybutyl]carbamate |
| SMILES | CCc1cccc(-c2c(Cl)cccc2C(O)(CCCNC(=O)OC)C2CCCN(C(=O)c3ccc(CN)cc3)C2)c1 |
| InChI | InChI=1S/C33H40ClN3O4/c1-3-23-8-4-9-26(20-23)30-28(11-5-12-29(30)34)33(40,17-7-18-36-32(39)41-2)27-10-6-19-37(22-27)31(38)25-15-13-24(21-35)14-16-25/h4-5,8-9,11-16,20,27,40H,3,6-7,10,17-19,21-22,35H2,1-2H3,(H,36,39) |
| InChIKey | VFJZEXNAAPENBI-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.15 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|