C37H46ClN3O5 — CID 68517514
[(4S)-4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxy-4-[(3R)-1-[4-[(oxan-4-ylamino)methyl]benzoyl]piperidin-3-yl]butyl]carbamic acid (PubChem CID 68517514) has the molecular formula C37H46ClN3O5 and a molecular weight of 648.24 g/mol. Its IUPAC name is [(4S)-4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxy-4-[(3R)-1-[4-[(oxan-4-ylamino)methyl]benzoyl]piperidin-3-yl]butyl]carbamic acid.
| Compound Name | [(4S)-4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxy-4-[(3R)-1-[4-[(oxan-4-ylamino)methyl]benzoyl]piperidin-3-yl]butyl]carbamic acid |
|---|---|
| PubChem CID | 68517514 |
| Molecular Formula | C37H46ClN3O5 |
| Molecular Weight | 648.24 g/mol |
| Exact Mass | 647.31 |
| IUPAC Name | [(4S)-4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxy-4-[(3R)-1-[4-[(oxan-4-ylamino)methyl]benzoyl]piperidin-3-yl]butyl]carbamic acid |
| SMILES | CCc1cccc(-c2c(Cl)cccc2[C@](O)(CCCNC(=O)O)[C@@H]2CCCN(C(=O)c3ccc(CNC4CCOCC4)cc3)C2)c1 |
| InChI | InChI=1S/C37H46ClN3O5/c1-2-26-7-3-8-29(23-26)34-32(10-4-11-33(34)38)37(45,18-6-19-39-36(43)44)30-9-5-20-41(25-30)35(42)28-14-12-27(13-15-28)24-40-31-16-21-46-22-17-31/h3-4,7-8,10-15,23,30-31,39-40,45H,2,5-6,9,16-22,24-25H2,1H3,(H,43,44)/t30-,37+/m1/s1 |
| InChIKey | XFBKXRMWNYJTDS-RZFQCGOMSA-N |
| XLogP | 6.63 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.24 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|