C34H41Cl2N3O4 — CID 68781924
[(4S)-4-[1-[(3R)-4-amino-3-(4-chlorophenyl)butanoyl]piperidin-3-yl]-4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxybutyl]carbamic acid (PubChem CID 68781924) has the molecular formula C34H41Cl2N3O4 and a molecular weight of 626.63 g/mol. Its IUPAC name is [(4S)-4-[1-[(3R)-4-amino-3-(4-chlorophenyl)butanoyl]piperidin-3-yl]-4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxybutyl]carbamic acid.
| Compound Name | [(4S)-4-[1-[(3R)-4-amino-3-(4-chlorophenyl)butanoyl]piperidin-3-yl]-4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxybutyl]carbamic acid |
|---|---|
| PubChem CID | 68781924 |
| Molecular Formula | C34H41Cl2N3O4 |
| Molecular Weight | 626.63 g/mol |
| Exact Mass | 625.25 |
| IUPAC Name | [(4S)-4-[1-[(3R)-4-amino-3-(4-chlorophenyl)butanoyl]piperidin-3-yl]-4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxybutyl]carbamic acid |
| SMILES | CCc1cccc(-c2c(Cl)cccc2[C@](O)(CCCNC(=O)O)C2CCCN(C(=O)C[C@@H](CN)c3ccc(Cl)cc3)C2)c1 |
| InChI | InChI=1S/C34H41Cl2N3O4/c1-2-23-7-3-8-25(19-23)32-29(10-4-11-30(32)36)34(43,16-6-17-38-33(41)42)27-9-5-18-39(22-27)31(40)20-26(21-37)24-12-14-28(35)15-13-24/h3-4,7-8,10-15,19,26-27,38,43H,2,5-6,9,16-18,20-22,37H2,1H3,(H,41,42)/t26-,27?,34-/m0/s1 |
| InChIKey | OELOXSKHLMPMKM-JGIFHQAGSA-N |
| XLogP | 6.83 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.63 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|