C32H44FN3O4 — CID 68762979
[(4S)-4-[2-(3-ethylphenyl)-3-fluorophenyl]-4-hydroxy-4-[1-(3-piperidin-2-ylpropanoyl)piperidin-3-yl]butyl]carbamic acid (PubChem CID 68762979) has the molecular formula C32H44FN3O4 and a molecular weight of 553.72 g/mol. Its IUPAC name is [(4S)-4-[2-(3-ethylphenyl)-3-fluorophenyl]-4-hydroxy-4-[1-(3-piperidin-2-ylpropanoyl)piperidin-3-yl]butyl]carbamic acid.
| Compound Name | [(4S)-4-[2-(3-ethylphenyl)-3-fluorophenyl]-4-hydroxy-4-[1-(3-piperidin-2-ylpropanoyl)piperidin-3-yl]butyl]carbamic acid |
|---|---|
| PubChem CID | 68762979 |
| Molecular Formula | C32H44FN3O4 |
| Molecular Weight | 553.72 g/mol |
| Exact Mass | 553.33 |
| IUPAC Name | [(4S)-4-[2-(3-ethylphenyl)-3-fluorophenyl]-4-hydroxy-4-[1-(3-piperidin-2-ylpropanoyl)piperidin-3-yl]butyl]carbamic acid |
| SMILES | CCc1cccc(-c2c(F)cccc2[C@](O)(CCCNC(=O)O)C2CCCN(C(=O)CCC3CCCCN3)C2)c1 |
| InChI | InChI=1S/C32H44FN3O4/c1-2-23-9-5-10-24(21-23)30-27(13-6-14-28(30)33)32(40,17-8-19-35-31(38)39)25-11-7-20-36(22-25)29(37)16-15-26-12-3-4-18-34-26/h5-6,9-10,13-14,21,25-26,34-35,40H,2-4,7-8,11-12,15-20,22H2,1H3,(H,38,39)/t25?,26?,32-/m0/s1 |
| InChIKey | KQVAXUZWIJKFPD-FFJARJNZSA-N |
| XLogP | 5.45 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.72 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|