C29H40FN5O4 — CID 68785976
[(4S)-4-[1-[4-(diaminomethylideneamino)butanoyl]piperidin-3-yl]-4-[2-(3-ethylphenyl)-3-fluorophenyl]-4-hydroxybutyl]carbamic acid (PubChem CID 68785976) has the molecular formula C29H40FN5O4 and a molecular weight of 541.67 g/mol. Its IUPAC name is [(4S)-4-[1-[4-(diaminomethylideneamino)butanoyl]piperidin-3-yl]-4-[2-(3-ethylphenyl)-3-fluorophenyl]-4-hydroxybutyl]carbamic acid.
| Compound Name | [(4S)-4-[1-[4-(diaminomethylideneamino)butanoyl]piperidin-3-yl]-4-[2-(3-ethylphenyl)-3-fluorophenyl]-4-hydroxybutyl]carbamic acid |
|---|---|
| PubChem CID | 68785976 |
| Molecular Formula | C29H40FN5O4 |
| Molecular Weight | 541.67 g/mol |
| Exact Mass | 541.31 |
| IUPAC Name | [(4S)-4-[1-[4-(diaminomethylideneamino)butanoyl]piperidin-3-yl]-4-[2-(3-ethylphenyl)-3-fluorophenyl]-4-hydroxybutyl]carbamic acid |
| SMILES | CCc1cccc(-c2c(F)cccc2[C@](O)(CCCNC(=O)O)C2CCCN(C(=O)CCCN=C(N)N)C2)c1 |
| InChI | InChI=1S/C29H40FN5O4/c1-2-20-8-3-9-21(18-20)26-23(11-4-12-24(26)30)29(39,14-7-16-34-28(37)38)22-10-6-17-35(19-22)25(36)13-5-15-33-27(31)32/h3-4,8-9,11-12,18,22,34,39H,2,5-7,10,13-17,19H2,1H3,(H,37,38)(H4,31,32,33)/t22?,29-/m0/s1 |
| InChIKey | HFGURUHEXRJLSO-JKDDQTOVSA-N |
| XLogP | 3.58 |
| TPSA | 154.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.67 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|