C28H38FN3O3 — CID 173104754
(4R)-4-amino-5-[3-[1-[2-(3-ethylphenyl)-3-fluorophenyl]-1-hydroxybutyl]piperidin-1-yl]-5-oxopentanamide (PubChem CID 173104754) has the molecular formula C28H38FN3O3 and a molecular weight of 483.63 g/mol. Its IUPAC name is (4R)-4-amino-5-[3-[1-[2-(3-ethylphenyl)-3-fluorophenyl]-1-hydroxybutyl]piperidin-1-yl]-5-oxopentanamide.
| Compound Name | (4R)-4-amino-5-[3-[1-[2-(3-ethylphenyl)-3-fluorophenyl]-1-hydroxybutyl]piperidin-1-yl]-5-oxopentanamide |
|---|---|
| PubChem CID | 173104754 |
| Molecular Formula | C28H38FN3O3 |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.29 |
| IUPAC Name | (4R)-4-amino-5-[3-[1-[2-(3-ethylphenyl)-3-fluorophenyl]-1-hydroxybutyl]piperidin-1-yl]-5-oxopentanamide |
| SMILES | CCCC(O)(c1cccc(F)c1-c1cccc(CC)c1)C1CCCN(C(=O)[C@H](N)CCC(N)=O)C1 |
| InChI | InChI=1S/C28H38FN3O3/c1-3-15-28(35,21-10-7-16-32(18-21)27(34)24(30)13-14-25(31)33)22-11-6-12-23(29)26(22)20-9-5-8-19(4-2)17-20/h5-6,8-9,11-12,17,21,24,35H,3-4,7,10,13-16,18,30H2,1-2H3,(H2,31,33)/t21?,24-,28?/m1/s1 |
| InChIKey | GYABPZYDWJJUGZ-MKNZIIIOSA-N |
| XLogP | 3.87 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |