C31H42FN3O4 — CID 24758129
methyl N-[(4S)-4-[2-(3-ethylphenyl)-3-fluorophenyl]-4-hydroxy-4-[(3R)-1-(piperidine-2-carbonyl)piperidin-3-yl]butyl]carbamate (PubChem CID 24758129) has the molecular formula C31H42FN3O4 and a molecular weight of 539.69 g/mol. Its IUPAC name is methyl N-[(4S)-4-[2-(3-ethylphenyl)-3-fluorophenyl]-4-hydroxy-4-[(3R)-1-(piperidine-2-carbonyl)piperidin-3-yl]butyl]carbamate.
| Compound Name | methyl N-[(4S)-4-[2-(3-ethylphenyl)-3-fluorophenyl]-4-hydroxy-4-[(3R)-1-(piperidine-2-carbonyl)piperidin-3-yl]butyl]carbamate |
|---|---|
| PubChem CID | 24758129 |
| Molecular Formula | C31H42FN3O4 |
| Molecular Weight | 539.69 g/mol |
| Exact Mass | 539.32 |
| IUPAC Name | methyl N-[(4S)-4-[2-(3-ethylphenyl)-3-fluorophenyl]-4-hydroxy-4-[(3R)-1-(piperidine-2-carbonyl)piperidin-3-yl]butyl]carbamate |
| SMILES | CCc1cccc(-c2c(F)cccc2[C@](O)(CCCNC(=O)OC)[C@@H]2CCCN(C(=O)C3CCCCN3)C2)c1 |
| InChI | InChI=1S/C31H42FN3O4/c1-3-22-10-6-11-23(20-22)28-25(13-7-14-26(28)32)31(38,16-9-18-34-30(37)39-2)24-12-8-19-35(21-24)29(36)27-15-4-5-17-33-27/h6-7,10-11,13-14,20,24,27,33,38H,3-5,8-9,12,15-19,21H2,1-2H3,(H,34,37)/t24-,27?,31+/m1/s1 |
| InChIKey | NNNYDXFUCSKCOO-MGVVVVGMSA-N |
| XLogP | 4.76 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.69 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|