C30H40FN3O5 — CID 25192914
[4-[2-(3-ethylphenyl)-3-fluorophenyl]-4-hydroxy-4-[1-(morpholine-2-carbonyl)piperidin-3-yl]butyl] N-methylcarbamate (PubChem CID 25192914) has the molecular formula C30H40FN3O5 and a molecular weight of 541.66 g/mol. Its IUPAC name is [4-[2-(3-ethylphenyl)-3-fluorophenyl]-4-hydroxy-4-[1-(morpholine-2-carbonyl)piperidin-3-yl]butyl] N-methylcarbamate.
| Compound Name | [4-[2-(3-ethylphenyl)-3-fluorophenyl]-4-hydroxy-4-[1-(morpholine-2-carbonyl)piperidin-3-yl]butyl] N-methylcarbamate |
|---|---|
| PubChem CID | 25192914 |
| Molecular Formula | C30H40FN3O5 |
| Molecular Weight | 541.66 g/mol |
| Exact Mass | 541.30 |
| IUPAC Name | [4-[2-(3-ethylphenyl)-3-fluorophenyl]-4-hydroxy-4-[1-(morpholine-2-carbonyl)piperidin-3-yl]butyl] N-methylcarbamate |
| SMILES | CCc1cccc(-c2c(F)cccc2C(O)(CCCOC(=O)NC)C2CCCN(C(=O)C3CNCCO3)C2)c1 |
| InChI | InChI=1S/C30H40FN3O5/c1-3-21-8-4-9-22(18-21)27-24(11-5-12-25(27)31)30(37,13-7-16-39-29(36)32-2)23-10-6-15-34(20-23)28(35)26-19-33-14-17-38-26/h4-5,8-9,11-12,18,23,26,33,37H,3,6-7,10,13-17,19-20H2,1-2H3,(H,32,36) |
| InChIKey | PRVLKIVSNVOTQP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.66 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|