C26H33ClN2O4 — CID 68515441
(3R)-3-[4-acetamido-1-[3-chloro-2-(3-ethylphenyl)phenyl]-1-hydroxybutyl]piperidine-1-carboxylic acid (PubChem CID 68515441) has the molecular formula C26H33ClN2O4 and a molecular weight of 473.01 g/mol. Its IUPAC name is (3R)-3-[4-acetamido-1-[3-chloro-2-(3-ethylphenyl)phenyl]-1-hydroxybutyl]piperidine-1-carboxylic acid.
| Compound Name | (3R)-3-[4-acetamido-1-[3-chloro-2-(3-ethylphenyl)phenyl]-1-hydroxybutyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 68515441 |
| Molecular Formula | C26H33ClN2O4 |
| Molecular Weight | 473.01 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | (3R)-3-[4-acetamido-1-[3-chloro-2-(3-ethylphenyl)phenyl]-1-hydroxybutyl]piperidine-1-carboxylic acid |
| SMILES | CCc1cccc(-c2c(Cl)cccc2C(O)(CCCNC(C)=O)[C@@H]2CCCN(C(=O)O)C2)c1 |
| InChI | InChI=1S/C26H33ClN2O4/c1-3-19-8-4-9-20(16-19)24-22(11-5-12-23(24)27)26(33,13-7-14-28-18(2)30)21-10-6-15-29(17-21)25(31)32/h4-5,8-9,11-12,16,21,33H,3,6-7,10,13-15,17H2,1-2H3,(H,28,30)(H,31,32)/t21-,26?/m1/s1 |
| InChIKey | SZAFLJVXRDXLHW-OSMGYRLQSA-N |
| XLogP | 5.06 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.01 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|