C39H50ClN3O4 — CID 68516030
[4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-[1-[4-[(cyclohexylmethylamino)methyl]benzoyl]piperidin-3-yl]-4-hydroxybutyl]carbamic acid (PubChem CID 68516030) has the molecular formula C39H50ClN3O4 and a molecular weight of 660.30 g/mol. Its IUPAC name is [4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-[1-[4-[(cyclohexylmethylamino)methyl]benzoyl]piperidin-3-yl]-4-hydroxybutyl]carbamic acid.
| Compound Name | [4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-[1-[4-[(cyclohexylmethylamino)methyl]benzoyl]piperidin-3-yl]-4-hydroxybutyl]carbamic acid |
|---|---|
| PubChem CID | 68516030 |
| Molecular Formula | C39H50ClN3O4 |
| Molecular Weight | 660.30 g/mol |
| Exact Mass | 659.35 |
| IUPAC Name | [4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-[1-[4-[(cyclohexylmethylamino)methyl]benzoyl]piperidin-3-yl]-4-hydroxybutyl]carbamic acid |
| SMILES | CCc1cccc(-c2c(Cl)cccc2C(O)(CCCNC(=O)O)C2CCCN(C(=O)c3ccc(CNCC4CCCCC4)cc3)C2)c1 |
| InChI | InChI=1S/C39H50ClN3O4/c1-2-28-12-6-13-32(24-28)36-34(15-7-16-35(36)40)39(47,21-9-22-42-38(45)46)33-14-8-23-43(27-33)37(44)31-19-17-30(18-20-31)26-41-25-29-10-4-3-5-11-29/h6-7,12-13,15-20,24,29,33,41-42,47H,2-5,8-11,14,21-23,25-27H2,1H3,(H,45,46) |
| InChIKey | ILQJZPXKYIADBK-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.30 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|