C34H42ClN3O4 — CID 68518501
[(4S)-4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-[(3R)-1-[4-(ethylaminomethyl)benzoyl]piperidin-3-yl]-4-hydroxybutyl]carbamic acid (PubChem CID 68518501) has the molecular formula C34H42ClN3O4 and a molecular weight of 592.18 g/mol. Its IUPAC name is [(4S)-4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-[(3R)-1-[4-(ethylaminomethyl)benzoyl]piperidin-3-yl]-4-hydroxybutyl]carbamic acid.
| Compound Name | [(4S)-4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-[(3R)-1-[4-(ethylaminomethyl)benzoyl]piperidin-3-yl]-4-hydroxybutyl]carbamic acid |
|---|---|
| PubChem CID | 68518501 |
| Molecular Formula | C34H42ClN3O4 |
| Molecular Weight | 592.18 g/mol |
| Exact Mass | 591.29 |
| IUPAC Name | [(4S)-4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-[(3R)-1-[4-(ethylaminomethyl)benzoyl]piperidin-3-yl]-4-hydroxybutyl]carbamic acid |
| SMILES | CCNCc1ccc(C(=O)N2CCC[C@@H]([C@@](O)(CCCNC(=O)O)c3cccc(Cl)c3-c3cccc(CC)c3)C2)cc1 |
| InChI | InChI=1S/C34H42ClN3O4/c1-3-24-9-5-10-27(21-24)31-29(12-6-13-30(31)35)34(42,18-8-19-37-33(40)41)28-11-7-20-38(23-28)32(39)26-16-14-25(15-17-26)22-36-4-2/h5-6,9-10,12-17,21,28,36-37,42H,3-4,7-8,11,18-20,22-23H2,1-2H3,(H,40,41)/t28-,34+/m1/s1 |
| InChIKey | XRDYPVJIKCZAMU-MYVCOICNSA-N |
| XLogP | 6.47 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.18 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|