C30H41ClN2O5 — CID 70284335
tert-butyl 3-[1-[3-chloro-2-(3-ethylphenyl)phenyl]-1-hydroxy-4-[(2-hydroxyacetyl)amino]butyl]piperidine-1-carboxylate (PubChem CID 70284335) has the molecular formula C30H41ClN2O5 and a molecular weight of 545.12 g/mol. Its IUPAC name is tert-butyl 3-[1-[3-chloro-2-(3-ethylphenyl)phenyl]-1-hydroxy-4-[(2-hydroxyacetyl)amino]butyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[1-[3-chloro-2-(3-ethylphenyl)phenyl]-1-hydroxy-4-[(2-hydroxyacetyl)amino]butyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 70284335 |
| Molecular Formula | C30H41ClN2O5 |
| Molecular Weight | 545.12 g/mol |
| Exact Mass | 544.27 |
| IUPAC Name | tert-butyl 3-[1-[3-chloro-2-(3-ethylphenyl)phenyl]-1-hydroxy-4-[(2-hydroxyacetyl)amino]butyl]piperidine-1-carboxylate |
| SMILES | CCc1cccc(-c2c(Cl)cccc2C(O)(CCCNC(=O)CO)C2CCCN(C(=O)OC(C)(C)C)C2)c1 |
| InChI | InChI=1S/C30H41ClN2O5/c1-5-21-10-6-11-22(18-21)27-24(13-7-14-25(27)31)30(37,15-9-16-32-26(35)20-34)23-12-8-17-33(19-23)28(36)38-29(2,3)4/h6-7,10-11,13-14,18,23,34,37H,5,8-9,12,15-17,19-20H2,1-4H3,(H,32,35) |
| InChIKey | YDDRSTWSCDJZRF-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.12 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|