C26H35ClN2O2 — CID 76641086
N-[4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxy-4-piperidin-3-ylbutyl]propanamide (PubChem CID 76641086) has the molecular formula C26H35ClN2O2 and a molecular weight of 443.03 g/mol. Its IUPAC name is N-[4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxy-4-piperidin-3-ylbutyl]propanamide.
| Compound Name | N-[4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxy-4-piperidin-3-ylbutyl]propanamide |
|---|---|
| PubChem CID | 76641086 |
| Molecular Formula | C26H35ClN2O2 |
| Molecular Weight | 443.03 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | N-[4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxy-4-piperidin-3-ylbutyl]propanamide |
| SMILES | CCC(=O)NCCCC(O)(c1cccc(Cl)c1-c1cccc(CC)c1)C1CCCNC1 |
| InChI | InChI=1S/C26H35ClN2O2/c1-3-19-9-5-10-20(17-19)25-22(12-6-13-23(25)27)26(31,21-11-7-15-28-18-21)14-8-16-29-24(30)4-2/h5-6,9-10,12-13,17,21,28,31H,3-4,7-8,11,14-16,18H2,1-2H3,(H,29,30) |
| InChIKey | BJKMQXVETYXPNP-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.03 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|