C32H39ClN4O4 — CID 87481694
[4-[2-chloro-3-(3-ethylphenyl)-4-pyridinyl]-4-hydroxy-4-[1-[4-(methylaminomethyl)benzoyl]piperidin-3-yl]butyl]carbamic acid (PubChem CID 87481694) has the molecular formula C32H39ClN4O4 and a molecular weight of 579.14 g/mol. Its IUPAC name is [4-[2-chloro-3-(3-ethylphenyl)-4-pyridinyl]-4-hydroxy-4-[1-[4-(methylaminomethyl)benzoyl]piperidin-3-yl]butyl]carbamic acid.
| Compound Name | [4-[2-chloro-3-(3-ethylphenyl)-4-pyridinyl]-4-hydroxy-4-[1-[4-(methylaminomethyl)benzoyl]piperidin-3-yl]butyl]carbamic acid |
|---|---|
| PubChem CID | 87481694 |
| Molecular Formula | C32H39ClN4O4 |
| Molecular Weight | 579.14 g/mol |
| Exact Mass | 578.27 |
| IUPAC Name | [4-[2-chloro-3-(3-ethylphenyl)-4-pyridinyl]-4-hydroxy-4-[1-[4-(methylaminomethyl)benzoyl]piperidin-3-yl]butyl]carbamic acid |
| SMILES | CCc1cccc(-c2c(C(O)(CCCNC(=O)O)C3CCCN(C(=O)c4ccc(CNC)cc4)C3)ccnc2Cl)c1 |
| InChI | InChI=1S/C32H39ClN4O4/c1-3-22-7-4-8-25(19-22)28-27(14-17-35-29(28)33)32(41,15-6-16-36-31(39)40)26-9-5-18-37(21-26)30(38)24-12-10-23(11-13-24)20-34-2/h4,7-8,10-14,17,19,26,34,36,41H,3,5-6,9,15-16,18,20-21H2,1-2H3,(H,39,40) |
| InChIKey | DUQIOXGTLNFEDR-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 114.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.14 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|