C33H41ClN4O4 — CID 87482051
[(4S)-4-[2-chloro-3-(3-propan-2-ylphenyl)-4-pyridinyl]-4-hydroxy-4-[(3R)-1-[4-(methylaminomethyl)benzoyl]piperidin-3-yl]butyl]carbamic acid (PubChem CID 87482051) has the molecular formula C33H41ClN4O4 and a molecular weight of 593.17 g/mol. Its IUPAC name is [(4S)-4-[2-chloro-3-(3-propan-2-ylphenyl)-4-pyridinyl]-4-hydroxy-4-[(3R)-1-[4-(methylaminomethyl)benzoyl]piperidin-3-yl]butyl]carbamic acid.
| Compound Name | [(4S)-4-[2-chloro-3-(3-propan-2-ylphenyl)-4-pyridinyl]-4-hydroxy-4-[(3R)-1-[4-(methylaminomethyl)benzoyl]piperidin-3-yl]butyl]carbamic acid |
|---|---|
| PubChem CID | 87482051 |
| Molecular Formula | C33H41ClN4O4 |
| Molecular Weight | 593.17 g/mol |
| Exact Mass | 592.28 |
| IUPAC Name | [(4S)-4-[2-chloro-3-(3-propan-2-ylphenyl)-4-pyridinyl]-4-hydroxy-4-[(3R)-1-[4-(methylaminomethyl)benzoyl]piperidin-3-yl]butyl]carbamic acid |
| SMILES | CNCc1ccc(C(=O)N2CCC[C@@H]([C@@](O)(CCCNC(=O)O)c3ccnc(Cl)c3-c3cccc(C(C)C)c3)C2)cc1 |
| InChI | InChI=1S/C33H41ClN4O4/c1-22(2)25-7-4-8-26(19-25)29-28(14-17-36-30(29)34)33(42,15-6-16-37-32(40)41)27-9-5-18-38(21-27)31(39)24-12-10-23(11-13-24)20-35-3/h4,7-8,10-14,17,19,22,27,35,37,42H,5-6,9,15-16,18,20-21H2,1-3H3,(H,40,41)/t27-,33+/m1/s1 |
| InChIKey | BQLBLFQAXHXFMY-SYBRLPANSA-N |
| XLogP | 6.03 |
| TPSA | 114.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.17 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|