C33H40FN3O3 — CID 68517510
N-[4-[3-fluoro-2-(3-methylphenyl)phenyl]-4-hydroxy-4-[1-[4-(methylaminomethyl)benzoyl]piperidin-3-yl]butyl]acetamide (PubChem CID 68517510) has the molecular formula C33H40FN3O3 and a molecular weight of 545.70 g/mol. Its IUPAC name is N-[4-[3-fluoro-2-(3-methylphenyl)phenyl]-4-hydroxy-4-[1-[4-(methylaminomethyl)benzoyl]piperidin-3-yl]butyl]acetamide.
| Compound Name | N-[4-[3-fluoro-2-(3-methylphenyl)phenyl]-4-hydroxy-4-[1-[4-(methylaminomethyl)benzoyl]piperidin-3-yl]butyl]acetamide |
|---|---|
| PubChem CID | 68517510 |
| Molecular Formula | C33H40FN3O3 |
| Molecular Weight | 545.70 g/mol |
| Exact Mass | 545.31 |
| IUPAC Name | N-[4-[3-fluoro-2-(3-methylphenyl)phenyl]-4-hydroxy-4-[1-[4-(methylaminomethyl)benzoyl]piperidin-3-yl]butyl]acetamide |
| SMILES | CNCc1ccc(C(=O)N2CCCC(C(O)(CCCNC(C)=O)c3cccc(F)c3-c3cccc(C)c3)C2)cc1 |
| InChI | InChI=1S/C33H40FN3O3/c1-23-8-4-9-27(20-23)31-29(11-5-12-30(31)34)33(40,17-7-18-36-24(2)38)28-10-6-19-37(22-28)32(39)26-15-13-25(14-16-26)21-35-3/h4-5,8-9,11-16,20,28,35,40H,6-7,10,17-19,21-22H2,1-3H3,(H,36,38) |
| InChIKey | UBAWGSOGMDBFLE-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.70 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|