C35H42FN7O4 — CID 145490963
methyl N-[4-[3-fluoro-2-(3-methylphenyl)phenyl]-4-hydroxy-4-[(3R)-1-[4-[[2-(2H-tetrazol-5-yl)ethylamino]methyl]benzoyl]piperidin-3-yl]butyl]carbamate (PubChem CID 145490963) has the molecular formula C35H42FN7O4 and a molecular weight of 643.76 g/mol. Its IUPAC name is methyl N-[4-[3-fluoro-2-(3-methylphenyl)phenyl]-4-hydroxy-4-[(3R)-1-[4-[[2-(2H-tetrazol-5-yl)ethylamino]methyl]benzoyl]piperidin-3-yl]butyl]carbamate.
| Compound Name | methyl N-[4-[3-fluoro-2-(3-methylphenyl)phenyl]-4-hydroxy-4-[(3R)-1-[4-[[2-(2H-tetrazol-5-yl)ethylamino]methyl]benzoyl]piperidin-3-yl]butyl]carbamate |
|---|---|
| PubChem CID | 145490963 |
| Molecular Formula | C35H42FN7O4 |
| Molecular Weight | 643.76 g/mol |
| Exact Mass | 643.33 |
| IUPAC Name | methyl N-[4-[3-fluoro-2-(3-methylphenyl)phenyl]-4-hydroxy-4-[(3R)-1-[4-[[2-(2H-tetrazol-5-yl)ethylamino]methyl]benzoyl]piperidin-3-yl]butyl]carbamate |
| SMILES | COC(=O)NCCCC(O)(c1cccc(F)c1-c1cccc(C)c1)[C@@H]1CCCN(C(=O)c2ccc(CNCCc3nn[nH]n3)cc2)C1 |
| InChI | InChI=1S/C35H42FN7O4/c1-24-7-3-8-27(21-24)32-29(10-4-11-30(32)36)35(46,17-6-18-38-34(45)47-2)28-9-5-20-43(23-28)33(44)26-14-12-25(13-15-26)22-37-19-16-31-39-41-42-40-31/h3-4,7-8,10-15,21,28,37,46H,5-6,9,16-20,22-23H2,1-2H3,(H,38,45)(H,39,40,41,42)/t28-,35?/m1/s1 |
| InChIKey | AXLQYJFPNTWELF-SEZSJYDQSA-N |
| XLogP | 4.52 |
| TPSA | 145.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.76 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|