C33H40ClN3O3 — CID 76641073
N-[4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxy-4-[1-[4-(methylaminomethyl)benzoyl]piperidin-3-yl]butyl]formamide (PubChem CID 76641073) has the molecular formula C33H40ClN3O3 and a molecular weight of 562.15 g/mol. Its IUPAC name is N-[4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxy-4-[1-[4-(methylaminomethyl)benzoyl]piperidin-3-yl]butyl]formamide.
| Compound Name | N-[4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxy-4-[1-[4-(methylaminomethyl)benzoyl]piperidin-3-yl]butyl]formamide |
|---|---|
| PubChem CID | 76641073 |
| Molecular Formula | C33H40ClN3O3 |
| Molecular Weight | 562.15 g/mol |
| Exact Mass | 561.28 |
| IUPAC Name | N-[4-[3-chloro-2-(3-ethylphenyl)phenyl]-4-hydroxy-4-[1-[4-(methylaminomethyl)benzoyl]piperidin-3-yl]butyl]formamide |
| SMILES | CCc1cccc(-c2c(Cl)cccc2C(O)(CCCNC=O)C2CCCN(C(=O)c3ccc(CNC)cc3)C2)c1 |
| InChI | InChI=1S/C33H40ClN3O3/c1-3-24-8-4-9-27(20-24)31-29(11-5-12-30(31)34)33(40,17-7-18-36-23-38)28-10-6-19-37(22-28)32(39)26-15-13-25(14-16-26)21-35-2/h4-5,8-9,11-16,20,23,28,35,40H,3,6-7,10,17-19,21-22H2,1-2H3,(H,36,38) |
| InChIKey | XUQPEZMAOJYNNF-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.15 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|