C33H40ClN3O3 — CID 145490974
methyl N-[4-[1-[4-(aminomethyl)benzoyl]piperidin-3-yl]-4-[3-chloro-2-(3-ethylphenyl)phenyl]butyl]carbamate (PubChem CID 145490974) has the molecular formula C33H40ClN3O3 and a molecular weight of 562.15 g/mol. Its IUPAC name is methyl N-[4-[1-[4-(aminomethyl)benzoyl]piperidin-3-yl]-4-[3-chloro-2-(3-ethylphenyl)phenyl]butyl]carbamate.
| Compound Name | methyl N-[4-[1-[4-(aminomethyl)benzoyl]piperidin-3-yl]-4-[3-chloro-2-(3-ethylphenyl)phenyl]butyl]carbamate |
|---|---|
| PubChem CID | 145490974 |
| Molecular Formula | C33H40ClN3O3 |
| Molecular Weight | 562.15 g/mol |
| Exact Mass | 561.28 |
| IUPAC Name | methyl N-[4-[1-[4-(aminomethyl)benzoyl]piperidin-3-yl]-4-[3-chloro-2-(3-ethylphenyl)phenyl]butyl]carbamate |
| SMILES | CCc1cccc(-c2c(Cl)cccc2C(CCCNC(=O)OC)C2CCCN(C(=O)c3ccc(CN)cc3)C2)c1 |
| InChI | InChI=1S/C33H40ClN3O3/c1-3-23-8-4-9-26(20-23)31-29(11-5-13-30(31)34)28(12-6-18-36-33(39)40-2)27-10-7-19-37(22-27)32(38)25-16-14-24(21-35)15-17-25/h4-5,8-9,11,13-17,20,27-28H,3,6-7,10,12,18-19,21-22,35H2,1-2H3,(H,36,39) |
| InChIKey | DPGBNDUUFRISLC-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.15 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|