C37H49ClN4O5 — CID 59620472
methyl N-[2-[(R)-[3-chloro-2-(3-ethylphenyl)phenyl]-[(3R)-1-[[(2S)-4-(4-methoxyphenyl)-2-(methylamino)butyl]carbamoyl]piperidin-3-yl]methoxy]ethyl]carbamate (PubChem CID 59620472) has the molecular formula C37H49ClN4O5 and a molecular weight of 665.28 g/mol. Its IUPAC name is methyl N-[2-[(R)-[3-chloro-2-(3-ethylphenyl)phenyl]-[(3R)-1-[[(2S)-4-(4-methoxyphenyl)-2-(methylamino)butyl]carbamoyl]piperidin-3-yl]methoxy]ethyl]carbamate.
| Compound Name | methyl N-[2-[(R)-[3-chloro-2-(3-ethylphenyl)phenyl]-[(3R)-1-[[(2S)-4-(4-methoxyphenyl)-2-(methylamino)butyl]carbamoyl]piperidin-3-yl]methoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 59620472 |
| Molecular Formula | C37H49ClN4O5 |
| Molecular Weight | 665.28 g/mol |
| Exact Mass | 664.34 |
| IUPAC Name | methyl N-[2-[(R)-[3-chloro-2-(3-ethylphenyl)phenyl]-[(3R)-1-[[(2S)-4-(4-methoxyphenyl)-2-(methylamino)butyl]carbamoyl]piperidin-3-yl]methoxy]ethyl]carbamate |
| SMILES | CCc1cccc(-c2c(Cl)cccc2[C@H](OCCNC(=O)OC)[C@@H]2CCCN(C(=O)NC[C@H](CCc3ccc(OC)cc3)NC)C2)c1 |
| InChI | InChI=1S/C37H49ClN4O5/c1-5-26-9-6-10-28(23-26)34-32(12-7-13-33(34)38)35(47-22-20-40-37(44)46-4)29-11-8-21-42(25-29)36(43)41-24-30(39-2)17-14-27-15-18-31(45-3)19-16-27/h6-7,9-10,12-13,15-16,18-19,23,29-30,35,39H,5,8,11,14,17,20-22,24-25H2,1-4H3,(H,40,44)(H,41,43)/t29-,30+,35-/m1/s1 |
| InChIKey | NBGSVANWDXTBIO-WFLWKIQJSA-N |
| XLogP | 6.63 |
| TPSA | 101.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.28 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|