C21H31ClN2O5 — CID 89497232
butyl 3-[(3-chlorophenyl)-[2-(methoxycarbonylamino)ethoxy]methyl]piperidine-1-carboxylate (PubChem CID 89497232) has the molecular formula C21H31ClN2O5 and a molecular weight of 426.94 g/mol. Its IUPAC name is butyl 3-[(3-chlorophenyl)-[2-(methoxycarbonylamino)ethoxy]methyl]piperidine-1-carboxylate.
| Compound Name | butyl 3-[(3-chlorophenyl)-[2-(methoxycarbonylamino)ethoxy]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 89497232 |
| Molecular Formula | C21H31ClN2O5 |
| Molecular Weight | 426.94 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | butyl 3-[(3-chlorophenyl)-[2-(methoxycarbonylamino)ethoxy]methyl]piperidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCCC(C(OCCNC(=O)OC)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C21H31ClN2O5/c1-3-4-12-29-21(26)24-11-6-8-17(15-24)19(16-7-5-9-18(22)14-16)28-13-10-23-20(25)27-2/h5,7,9,14,17,19H,3-4,6,8,10-13,15H2,1-2H3,(H,23,25) |
| InChIKey | XNXXNDXZQCEWDU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.94 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|