C20H31ClN2O3 — CID 68857402
methyl N-[2-[(R)-[(3R)-1-tert-butylpiperidin-3-yl]-(3-chlorophenyl)methoxy]ethyl]carbamate (PubChem CID 68857402) has the molecular formula C20H31ClN2O3 and a molecular weight of 382.93 g/mol. Its IUPAC name is methyl N-[2-[(R)-[(3R)-1-tert-butylpiperidin-3-yl]-(3-chlorophenyl)methoxy]ethyl]carbamate.
| Compound Name | methyl N-[2-[(R)-[(3R)-1-tert-butylpiperidin-3-yl]-(3-chlorophenyl)methoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 68857402 |
| Molecular Formula | C20H31ClN2O3 |
| Molecular Weight | 382.93 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | methyl N-[2-[(R)-[(3R)-1-tert-butylpiperidin-3-yl]-(3-chlorophenyl)methoxy]ethyl]carbamate |
| SMILES | COC(=O)NCCO[C@@H](c1cccc(Cl)c1)[C@@H]1CCCN(C(C)(C)C)C1 |
| InChI | InChI=1S/C20H31ClN2O3/c1-20(2,3)23-11-6-8-16(14-23)18(15-7-5-9-17(21)13-15)26-12-10-22-19(24)25-4/h5,7,9,13,16,18H,6,8,10-12,14H2,1-4H3,(H,22,24)/t16-,18+/m1/s1 |
| InChIKey | MXYHLSCSGSHBMQ-AEFFLSMTSA-N |
| XLogP | 4.26 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.93 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|