C26H40ClN3O5 — CID 157108333
methyl N-[2-[(R)-[(3R)-1-[(4R)-4-amino-5-[(3R)-oxan-3-yl]pentanoyl]piperidin-3-yl]-(3-chlorophenyl)methoxy]ethyl]carbamate (PubChem CID 157108333) has the molecular formula C26H40ClN3O5 and a molecular weight of 510.08 g/mol. Its IUPAC name is methyl N-[2-[(R)-[(3R)-1-[(4R)-4-amino-5-[(3R)-oxan-3-yl]pentanoyl]piperidin-3-yl]-(3-chlorophenyl)methoxy]ethyl]carbamate.
| Compound Name | methyl N-[2-[(R)-[(3R)-1-[(4R)-4-amino-5-[(3R)-oxan-3-yl]pentanoyl]piperidin-3-yl]-(3-chlorophenyl)methoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 157108333 |
| Molecular Formula | C26H40ClN3O5 |
| Molecular Weight | 510.08 g/mol |
| Exact Mass | 509.27 |
| IUPAC Name | methyl N-[2-[(R)-[(3R)-1-[(4R)-4-amino-5-[(3R)-oxan-3-yl]pentanoyl]piperidin-3-yl]-(3-chlorophenyl)methoxy]ethyl]carbamate |
| SMILES | COC(=O)NCCO[C@@H](c1cccc(Cl)c1)[C@@H]1CCCN(C(=O)CC[C@@H](N)C[C@H]2CCCOC2)C1 |
| InChI | InChI=1S/C26H40ClN3O5/c1-33-26(32)29-11-14-35-25(20-6-2-8-22(27)16-20)21-7-3-12-30(17-21)24(31)10-9-23(28)15-19-5-4-13-34-18-19/h2,6,8,16,19,21,23,25H,3-5,7,9-15,17-18,28H2,1H3,(H,29,32)/t19-,21-,23-,25+/m1/s1 |
| InChIKey | NSQPMKGTVYHONV-YTAKYCMFSA-N |
| XLogP | 3.92 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.08 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|