C27H42ClFN4O4 — CID 68711946
methyl N-[2-[(3-chlorophenyl)-[(3R)-1-[[(2S)-1-(4-fluorocyclohexyl)-3-(methylamino)propan-2-yl]carbamoyl]piperidin-3-yl]methoxy]ethyl]carbamate (PubChem CID 68711946) has the molecular formula C27H42ClFN4O4 and a molecular weight of 541.11 g/mol. Its IUPAC name is methyl N-[2-[(3-chlorophenyl)-[(3R)-1-[[(2S)-1-(4-fluorocyclohexyl)-3-(methylamino)propan-2-yl]carbamoyl]piperidin-3-yl]methoxy]ethyl]carbamate.
| Compound Name | methyl N-[2-[(3-chlorophenyl)-[(3R)-1-[[(2S)-1-(4-fluorocyclohexyl)-3-(methylamino)propan-2-yl]carbamoyl]piperidin-3-yl]methoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 68711946 |
| Molecular Formula | C27H42ClFN4O4 |
| Molecular Weight | 541.11 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | methyl N-[2-[(3-chlorophenyl)-[(3R)-1-[[(2S)-1-(4-fluorocyclohexyl)-3-(methylamino)propan-2-yl]carbamoyl]piperidin-3-yl]methoxy]ethyl]carbamate |
| SMILES | CNC[C@H](CC1CCC(F)CC1)NC(=O)N1CCC[C@@H](C(OCCNC(=O)OC)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C27H42ClFN4O4/c1-30-17-24(15-19-8-10-23(29)11-9-19)32-26(34)33-13-4-6-21(18-33)25(20-5-3-7-22(28)16-20)37-14-12-31-27(35)36-2/h3,5,7,16,19,21,23-25,30H,4,6,8-15,17-18H2,1-2H3,(H,31,35)(H,32,34)/t19?,21-,23?,24+,25?/m1/s1 |
| InChIKey | XLQXSVHXORROEM-CWHWPMDLSA-N |
| XLogP | 4.68 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.11 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|