C28H45ClN4O4 — CID 59201678
(3R)-3-[(R)-(3-chlorophenyl)-[2-(2-methoxyethylamino)-2-oxoethoxy]methyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide (PubChem CID 59201678) has the molecular formula C28H45ClN4O4 and a molecular weight of 537.15 g/mol. Its IUPAC name is (3R)-3-[(R)-(3-chlorophenyl)-[2-(2-methoxyethylamino)-2-oxoethoxy]methyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide.
| Compound Name | (3R)-3-[(R)-(3-chlorophenyl)-[2-(2-methoxyethylamino)-2-oxoethoxy]methyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 59201678 |
| Molecular Formula | C28H45ClN4O4 |
| Molecular Weight | 537.15 g/mol |
| Exact Mass | 536.31 |
| IUPAC Name | (3R)-3-[(R)-(3-chlorophenyl)-[2-(2-methoxyethylamino)-2-oxoethoxy]methyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide |
| SMILES | CNC[C@H](CC1CCCCC1)NC(=O)N1CCC[C@@H]([C@@H](OCC(=O)NCCOC)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C28H45ClN4O4/c1-30-18-25(16-21-8-4-3-5-9-21)32-28(35)33-14-7-11-23(19-33)27(22-10-6-12-24(29)17-22)37-20-26(34)31-13-15-36-2/h6,10,12,17,21,23,25,27,30H,3-5,7-9,11,13-16,18-20H2,1-2H3,(H,31,34)(H,32,35)/t23-,25+,27+/m1/s1 |
| InChIKey | ZDYBVHKDFOBEMJ-NIYJGHKDSA-N |
| XLogP | 4.14 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.15 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|