C25H39ClN4O3 — CID 59201560
[(R)-(3-chlorophenyl)-[(3R)-1-[[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]carbamoyl]piperidin-3-yl]methyl] N-methylcarbamate (PubChem CID 59201560) has the molecular formula C25H39ClN4O3 and a molecular weight of 479.07 g/mol. Its IUPAC name is [(R)-(3-chlorophenyl)-[(3R)-1-[[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]carbamoyl]piperidin-3-yl]methyl] N-methylcarbamate.
| Compound Name | [(R)-(3-chlorophenyl)-[(3R)-1-[[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]carbamoyl]piperidin-3-yl]methyl] N-methylcarbamate |
|---|---|
| PubChem CID | 59201560 |
| Molecular Formula | C25H39ClN4O3 |
| Molecular Weight | 479.07 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | [(R)-(3-chlorophenyl)-[(3R)-1-[[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]carbamoyl]piperidin-3-yl]methyl] N-methylcarbamate |
| SMILES | CNC[C@H](CC1CCCCC1)NC(=O)N1CCC[C@@H]([C@@H](OC(=O)NC)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C25H39ClN4O3/c1-27-16-22(14-18-8-4-3-5-9-18)29-24(31)30-13-7-11-20(17-30)23(33-25(32)28-2)19-10-6-12-21(26)15-19/h6,10,12,15,18,20,22-23,27H,3-5,7-9,11,13-14,16-17H2,1-2H3,(H,28,32)(H,29,31)/t20-,22+,23+/m1/s1 |
| InChIKey | CPPXMLHBYPVROQ-PUHATCMVSA-N |
| XLogP | 4.72 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.07 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |