C29H47ClN4O3 — CID 59201547
(3R)-3-[(R)-(3-chlorophenyl)-[3-oxo-3-(propylamino)propoxy]methyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide (PubChem CID 59201547) has the molecular formula C29H47ClN4O3 and a molecular weight of 535.17 g/mol. Its IUPAC name is (3R)-3-[(R)-(3-chlorophenyl)-[3-oxo-3-(propylamino)propoxy]methyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide.
| Compound Name | (3R)-3-[(R)-(3-chlorophenyl)-[3-oxo-3-(propylamino)propoxy]methyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 59201547 |
| Molecular Formula | C29H47ClN4O3 |
| Molecular Weight | 535.17 g/mol |
| Exact Mass | 534.33 |
| IUPAC Name | (3R)-3-[(R)-(3-chlorophenyl)-[3-oxo-3-(propylamino)propoxy]methyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide |
| SMILES | CCCNC(=O)CCO[C@@H](c1cccc(Cl)c1)[C@@H]1CCCN(C(=O)N[C@H](CNC)CC2CCCCC2)C1 |
| InChI | InChI=1S/C29H47ClN4O3/c1-3-15-32-27(35)14-17-37-28(23-11-7-13-25(30)19-23)24-12-8-16-34(21-24)29(36)33-26(20-31-2)18-22-9-5-4-6-10-22/h7,11,13,19,22,24,26,28,31H,3-6,8-10,12,14-18,20-21H2,1-2H3,(H,32,35)(H,33,36)/t24-,26+,28+/m1/s1 |
| InChIKey | NSODOSBWJAIIDP-XDIPAPSNSA-N |
| XLogP | 5.29 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.17 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |