C26H41ClN4O4 — CID 68710025
2-[(3-chlorophenyl)-[(3R)-1-[[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]carbamoyl]piperidin-3-yl]methoxy]ethylcarbamic acid (PubChem CID 68710025) has the molecular formula C26H41ClN4O4 and a molecular weight of 509.09 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)-[(3R)-1-[[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]carbamoyl]piperidin-3-yl]methoxy]ethylcarbamic acid.
| Compound Name | 2-[(3-chlorophenyl)-[(3R)-1-[[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]carbamoyl]piperidin-3-yl]methoxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 68710025 |
| Molecular Formula | C26H41ClN4O4 |
| Molecular Weight | 509.09 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | 2-[(3-chlorophenyl)-[(3R)-1-[[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]carbamoyl]piperidin-3-yl]methoxy]ethylcarbamic acid |
| SMILES | CNC[C@H](CC1CCCCC1)NC(=O)N1CCC[C@@H](C(OCCNC(=O)O)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C26H41ClN4O4/c1-28-17-23(15-19-7-3-2-4-8-19)30-25(32)31-13-6-10-21(18-31)24(35-14-12-29-26(33)34)20-9-5-11-22(27)16-20/h5,9,11,16,19,21,23-24,28-29H,2-4,6-8,10,12-15,17-18H2,1H3,(H,30,32)(H,33,34)/t21-,23+,24?/m1/s1 |
| InChIKey | PSTJCNCYVMPQOU-RZVHPXSESA-N |
| XLogP | 4.65 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.09 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|