C25H39ClN4O5 — CID 68709348
2-[(3-chlorophenyl)-[4-[[1-cyclohexyl-3-(methylamino)propan-2-yl]carbamoyl]morpholin-2-yl]methoxy]ethylcarbamic acid (PubChem CID 68709348) has the molecular formula C25H39ClN4O5 and a molecular weight of 511.06 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)-[4-[[1-cyclohexyl-3-(methylamino)propan-2-yl]carbamoyl]morpholin-2-yl]methoxy]ethylcarbamic acid.
| Compound Name | 2-[(3-chlorophenyl)-[4-[[1-cyclohexyl-3-(methylamino)propan-2-yl]carbamoyl]morpholin-2-yl]methoxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 68709348 |
| Molecular Formula | C25H39ClN4O5 |
| Molecular Weight | 511.06 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | 2-[(3-chlorophenyl)-[4-[[1-cyclohexyl-3-(methylamino)propan-2-yl]carbamoyl]morpholin-2-yl]methoxy]ethylcarbamic acid |
| SMILES | CNCC(CC1CCCCC1)NC(=O)N1CCOC(C(OCCNC(=O)O)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C25H39ClN4O5/c1-27-16-21(14-18-6-3-2-4-7-18)29-24(31)30-11-13-34-22(17-30)23(35-12-10-28-25(32)33)19-8-5-9-20(26)15-19/h5,8-9,15,18,21-23,27-28H,2-4,6-7,10-14,16-17H2,1H3,(H,29,31)(H,32,33) |
| InChIKey | OUCHEFSFFAZJFD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 112.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.06 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|