C27H42ClN3O5 — CID 59201465
methyl N-[2-[(R)-(3-chlorophenyl)-[(3R)-1-[[(2R)-1-(oxan-4-yl)pentan-2-yl]carbamoyl]piperidin-3-yl]methoxy]ethyl]carbamate (PubChem CID 59201465) has the molecular formula C27H42ClN3O5 and a molecular weight of 524.10 g/mol. Its IUPAC name is methyl N-[2-[(R)-(3-chlorophenyl)-[(3R)-1-[[(2R)-1-(oxan-4-yl)pentan-2-yl]carbamoyl]piperidin-3-yl]methoxy]ethyl]carbamate.
| Compound Name | methyl N-[2-[(R)-(3-chlorophenyl)-[(3R)-1-[[(2R)-1-(oxan-4-yl)pentan-2-yl]carbamoyl]piperidin-3-yl]methoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 59201465 |
| Molecular Formula | C27H42ClN3O5 |
| Molecular Weight | 524.10 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | methyl N-[2-[(R)-(3-chlorophenyl)-[(3R)-1-[[(2R)-1-(oxan-4-yl)pentan-2-yl]carbamoyl]piperidin-3-yl]methoxy]ethyl]carbamate |
| SMILES | CCC[C@H](CC1CCOCC1)NC(=O)N1CCC[C@@H]([C@@H](OCCNC(=O)OC)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C27H42ClN3O5/c1-3-6-24(17-20-10-14-35-15-11-20)30-26(32)31-13-5-8-22(19-31)25(21-7-4-9-23(28)18-21)36-16-12-29-27(33)34-2/h4,7,9,18,20,22,24-25H,3,5-6,8,10-17,19H2,1-2H3,(H,29,33)(H,30,32)/t22-,24-,25+/m1/s1 |
| InChIKey | KVEHMCAHECWUEK-GPXOXTDOSA-N |
| XLogP | 5.16 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.10 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|