C26H43N3O5Si — CID 173296838
methyl N-[2-[(R)-[(3R)-1-[[(2S)-1-methylsilyl-3-(oxan-4-yl)propan-2-yl]carbamoyl]piperidin-3-yl]-phenylmethoxy]ethyl]carbamate (PubChem CID 173296838) has the molecular formula C26H43N3O5Si and a molecular weight of 505.73 g/mol. Its IUPAC name is methyl N-[2-[(R)-[(3R)-1-[[(2S)-1-methylsilyl-3-(oxan-4-yl)propan-2-yl]carbamoyl]piperidin-3-yl]-phenylmethoxy]ethyl]carbamate.
| Compound Name | methyl N-[2-[(R)-[(3R)-1-[[(2S)-1-methylsilyl-3-(oxan-4-yl)propan-2-yl]carbamoyl]piperidin-3-yl]-phenylmethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 173296838 |
| Molecular Formula | C26H43N3O5Si |
| Molecular Weight | 505.73 g/mol |
| Exact Mass | 505.30 |
| IUPAC Name | methyl N-[2-[(R)-[(3R)-1-[[(2S)-1-methylsilyl-3-(oxan-4-yl)propan-2-yl]carbamoyl]piperidin-3-yl]-phenylmethoxy]ethyl]carbamate |
| SMILES | COC(=O)NCCO[C@@H](c1ccccc1)[C@@H]1CCCN(C(=O)N[C@H](C[SiH2]C)CC2CCOCC2)C1 |
| InChI | InChI=1S/C26H43N3O5Si/c1-32-26(31)27-12-16-34-24(21-7-4-3-5-8-21)22-9-6-13-29(18-22)25(30)28-23(19-35-2)17-20-10-14-33-15-11-20/h3-5,7-8,20,22-24H,6,9-19,35H2,1-2H3,(H,27,31)(H,28,30)/t22-,23+,24+/m1/s1 |
| InChIKey | BMCRGXSBPJVZIB-SGNDLWITSA-N |
| XLogP | 3.34 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.73 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|