C26H43N3O3 — CID 143215087
N-[(2S)-1-amino-3-cyclohexylpropan-2-yl]-3-[(R)-3-methoxypropoxy(phenyl)methyl]piperidine-1-carboxamide (PubChem CID 143215087) has the molecular formula C26H43N3O3 and a molecular weight of 445.65 g/mol. Its IUPAC name is N-[(2S)-1-amino-3-cyclohexylpropan-2-yl]-3-[(R)-3-methoxypropoxy(phenyl)methyl]piperidine-1-carboxamide.
| Compound Name | N-[(2S)-1-amino-3-cyclohexylpropan-2-yl]-3-[(R)-3-methoxypropoxy(phenyl)methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 143215087 |
| Molecular Formula | C26H43N3O3 |
| Molecular Weight | 445.65 g/mol |
| Exact Mass | 445.33 |
| IUPAC Name | N-[(2S)-1-amino-3-cyclohexylpropan-2-yl]-3-[(R)-3-methoxypropoxy(phenyl)methyl]piperidine-1-carboxamide |
| SMILES | COCCCO[C@@H](c1ccccc1)C1CCCN(C(=O)N[C@H](CN)CC2CCCCC2)C1 |
| InChI | InChI=1S/C26H43N3O3/c1-31-16-9-17-32-25(22-12-6-3-7-13-22)23-14-8-15-29(20-23)26(30)28-24(19-27)18-21-10-4-2-5-11-21/h3,6-7,12-13,21,23-25H,2,4-5,8-11,14-20,27H2,1H3,(H,28,30)/t23?,24-,25-/m0/s1 |
| InChIKey | WMJKWWVIOIGGCK-DJHGOXGWSA-N |
| XLogP | 4.50 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.65 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|