C32H49N3O3 — CID 11642180
N-[1-cyclohexyl-3-(methylamino)propan-2-yl]-3-[[2-(2-cyclopropylethynyl)phenyl]-(3-methoxypropoxy)methyl]piperidine-1-carboxamide (PubChem CID 11642180) has the molecular formula C32H49N3O3 and a molecular weight of 523.76 g/mol. Its IUPAC name is N-[1-cyclohexyl-3-(methylamino)propan-2-yl]-3-[[2-(2-cyclopropylethynyl)phenyl]-(3-methoxypropoxy)methyl]piperidine-1-carboxamide.
| Compound Name | N-[1-cyclohexyl-3-(methylamino)propan-2-yl]-3-[[2-(2-cyclopropylethynyl)phenyl]-(3-methoxypropoxy)methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 11642180 |
| Molecular Formula | C32H49N3O3 |
| Molecular Weight | 523.76 g/mol |
| Exact Mass | 523.38 |
| IUPAC Name | N-[1-cyclohexyl-3-(methylamino)propan-2-yl]-3-[[2-(2-cyclopropylethynyl)phenyl]-(3-methoxypropoxy)methyl]piperidine-1-carboxamide |
| SMILES | CNCC(CC1CCCCC1)NC(=O)N1CCCC(C(OCCCOC)c2ccccc2C#CC2CC2)C1 |
| InChI | InChI=1S/C32H49N3O3/c1-33-23-29(22-26-10-4-3-5-11-26)34-32(36)35-19-8-13-28(24-35)31(38-21-9-20-37-2)30-14-7-6-12-27(30)18-17-25-15-16-25/h6-7,12,14,25-26,28-29,31,33H,3-5,8-11,13,15-16,19-24H2,1-2H3,(H,34,36) |
| InChIKey | VEJFWLMHMWLJRX-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.76 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|