C33H50N2O3 — CID 58247048
(3R)-3-(cyclohexylmethyl)-1-[(3R)-3-[(R)-[2-(2-cyclopropylethynyl)phenyl]-(3-methoxypropoxy)methyl]piperidin-1-yl]-4-(methylamino)butan-1-one (PubChem CID 58247048) has the molecular formula C33H50N2O3 and a molecular weight of 522.77 g/mol. Its IUPAC name is (3R)-3-(cyclohexylmethyl)-1-[(3R)-3-[(R)-[2-(2-cyclopropylethynyl)phenyl]-(3-methoxypropoxy)methyl]piperidin-1-yl]-4-(methylamino)butan-1-one.
| Compound Name | (3R)-3-(cyclohexylmethyl)-1-[(3R)-3-[(R)-[2-(2-cyclopropylethynyl)phenyl]-(3-methoxypropoxy)methyl]piperidin-1-yl]-4-(methylamino)butan-1-one |
|---|---|
| PubChem CID | 58247048 |
| Molecular Formula | C33H50N2O3 |
| Molecular Weight | 522.77 g/mol |
| Exact Mass | 522.38 |
| IUPAC Name | (3R)-3-(cyclohexylmethyl)-1-[(3R)-3-[(R)-[2-(2-cyclopropylethynyl)phenyl]-(3-methoxypropoxy)methyl]piperidin-1-yl]-4-(methylamino)butan-1-one |
| SMILES | CNC[C@@H](CC(=O)N1CCC[C@@H]([C@@H](OCCCOC)c2ccccc2C#CC2CC2)C1)CC1CCCCC1 |
| InChI | InChI=1S/C33H50N2O3/c1-34-24-28(22-27-10-4-3-5-11-27)23-32(36)35-19-8-13-30(25-35)33(38-21-9-20-37-2)31-14-7-6-12-29(31)18-17-26-15-16-26/h6-7,12,14,26-28,30,33-34H,3-5,8-11,13,15-16,19-25H2,1-2H3/t28-,30-,33-/m1/s1 |
| InChIKey | CVZVTNVQMLMMMW-OUTLAKLDSA-N |
| XLogP | 5.98 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.77 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|