C29H49N3O3 — CID 67194545
(3R)-N-[1-cyclohexyl-3-(propylamino)propan-2-yl]-3-[(R)-3-methoxypropoxy(phenyl)methyl]piperidine-1-carboxamide (PubChem CID 67194545) has the molecular formula C29H49N3O3 and a molecular weight of 487.73 g/mol. Its IUPAC name is (3R)-N-[1-cyclohexyl-3-(propylamino)propan-2-yl]-3-[(R)-3-methoxypropoxy(phenyl)methyl]piperidine-1-carboxamide.
| Compound Name | (3R)-N-[1-cyclohexyl-3-(propylamino)propan-2-yl]-3-[(R)-3-methoxypropoxy(phenyl)methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 67194545 |
| Molecular Formula | C29H49N3O3 |
| Molecular Weight | 487.73 g/mol |
| Exact Mass | 487.38 |
| IUPAC Name | (3R)-N-[1-cyclohexyl-3-(propylamino)propan-2-yl]-3-[(R)-3-methoxypropoxy(phenyl)methyl]piperidine-1-carboxamide |
| SMILES | CCCNCC(CC1CCCCC1)NC(=O)N1CCC[C@@H]([C@@H](OCCCOC)c2ccccc2)C1 |
| InChI | InChI=1S/C29H49N3O3/c1-3-17-30-22-27(21-24-12-6-4-7-13-24)31-29(33)32-18-10-16-26(23-32)28(35-20-11-19-34-2)25-14-8-5-9-15-25/h5,8-9,14-15,24,26-28,30H,3-4,6-7,10-13,16-23H2,1-2H3,(H,31,33)/t26-,27?,28+/m1/s1 |
| InChIKey | WEKCPLAVBPNHRX-UNQNHFTRSA-N |
| XLogP | 5.54 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.73 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|