C27H45N3O3 — CID 67193802
(3R)-N-[(2S)-1-amino-3-cyclohexylpropan-2-yl]-3-[3-ethoxypropoxy(phenyl)methyl]piperidine-1-carboxamide (PubChem CID 67193802) has the molecular formula C27H45N3O3 and a molecular weight of 459.68 g/mol. Its IUPAC name is (3R)-N-[(2S)-1-amino-3-cyclohexylpropan-2-yl]-3-[3-ethoxypropoxy(phenyl)methyl]piperidine-1-carboxamide.
| Compound Name | (3R)-N-[(2S)-1-amino-3-cyclohexylpropan-2-yl]-3-[3-ethoxypropoxy(phenyl)methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 67193802 |
| Molecular Formula | C27H45N3O3 |
| Molecular Weight | 459.68 g/mol |
| Exact Mass | 459.35 |
| IUPAC Name | (3R)-N-[(2S)-1-amino-3-cyclohexylpropan-2-yl]-3-[3-ethoxypropoxy(phenyl)methyl]piperidine-1-carboxamide |
| SMILES | CCOCCCOC(c1ccccc1)[C@@H]1CCCN(C(=O)N[C@H](CN)CC2CCCCC2)C1 |
| InChI | InChI=1S/C27H45N3O3/c1-2-32-17-10-18-33-26(23-13-7-4-8-14-23)24-15-9-16-30(21-24)27(31)29-25(20-28)19-22-11-5-3-6-12-22/h4,7-8,13-14,22,24-26H,2-3,5-6,9-12,15-21,28H2,1H3,(H,29,31)/t24-,25+,26?/m1/s1 |
| InChIKey | DOQMKUCDLJZWHR-DUGVZXTISA-N |
| XLogP | 4.89 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.68 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|