C29H48N2O3 — CID 59383001
(3R)-N-[(2S)-1-amino-3-cyclohexylpropan-2-yl]-3-[(R)-3-ethoxypropoxy(phenyl)methyl]-3-methylcyclohexane-1-carboxamide (PubChem CID 59383001) has the molecular formula C29H48N2O3 and a molecular weight of 472.71 g/mol. Its IUPAC name is (3R)-N-[(2S)-1-amino-3-cyclohexylpropan-2-yl]-3-[(R)-3-ethoxypropoxy(phenyl)methyl]-3-methylcyclohexane-1-carboxamide.
| Compound Name | (3R)-N-[(2S)-1-amino-3-cyclohexylpropan-2-yl]-3-[(R)-3-ethoxypropoxy(phenyl)methyl]-3-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 59383001 |
| Molecular Formula | C29H48N2O3 |
| Molecular Weight | 472.71 g/mol |
| Exact Mass | 472.37 |
| IUPAC Name | (3R)-N-[(2S)-1-amino-3-cyclohexylpropan-2-yl]-3-[(R)-3-ethoxypropoxy(phenyl)methyl]-3-methylcyclohexane-1-carboxamide |
| SMILES | CCOCCCO[C@@H](c1ccccc1)[C@]1(C)CCCC(C(=O)N[C@H](CN)CC2CCCCC2)C1 |
| InChI | InChI=1S/C29H48N2O3/c1-3-33-18-11-19-34-27(24-14-8-5-9-15-24)29(2)17-10-16-25(21-29)28(32)31-26(22-30)20-23-12-6-4-7-13-23/h5,8-9,14-15,23,25-27H,3-4,6-7,10-13,16-22,30H2,1-2H3,(H,31,32)/t25?,26-,27-,29+/m0/s1 |
| InChIKey | PQPBJJLNUUQGRT-PNTFUYSISA-N |
| XLogP | 5.78 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.71 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|