C29H47N3O2 — CID 67191387
N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]-3-[(E)-5-ethoxy-1-phenylpent-1-enyl]piperidine-1-carboxamide (PubChem CID 67191387) has the molecular formula C29H47N3O2 and a molecular weight of 469.71 g/mol. Its IUPAC name is N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]-3-[(E)-5-ethoxy-1-phenylpent-1-enyl]piperidine-1-carboxamide.
| Compound Name | N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]-3-[(E)-5-ethoxy-1-phenylpent-1-enyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 67191387 |
| Molecular Formula | C29H47N3O2 |
| Molecular Weight | 469.71 g/mol |
| Exact Mass | 469.37 |
| IUPAC Name | N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]-3-[(E)-5-ethoxy-1-phenylpent-1-enyl]piperidine-1-carboxamide |
| SMILES | CCOCCC/C=C(/c1ccccc1)C1CCCN(C(=O)N[C@H](CNC)CC2CCCCC2)C1 |
| InChI | InChI=1S/C29H47N3O2/c1-3-34-20-11-10-18-28(25-15-8-5-9-16-25)26-17-12-19-32(23-26)29(33)31-27(22-30-2)21-24-13-6-4-7-14-24/h5,8-9,15-16,18,24,26-27,30H,3-4,6-7,10-14,17,19-23H2,1-2H3,(H,31,33)/b28-18-/t26?,27-/m0/s1 |
| InChIKey | IHQMIWUDZNICDJ-UWMONDFHSA-N |
| XLogP | 5.87 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.71 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|