C28H46FN3O3 — CID 67190425
(3R)-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]-3-[3-ethoxypropoxy-(3-fluorophenyl)methyl]piperidine-1-carboxamide (PubChem CID 67190425) has the molecular formula C28H46FN3O3 and a molecular weight of 491.69 g/mol. Its IUPAC name is (3R)-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]-3-[3-ethoxypropoxy-(3-fluorophenyl)methyl]piperidine-1-carboxamide.
| Compound Name | (3R)-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]-3-[3-ethoxypropoxy-(3-fluorophenyl)methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 67190425 |
| Molecular Formula | C28H46FN3O3 |
| Molecular Weight | 491.69 g/mol |
| Exact Mass | 491.35 |
| IUPAC Name | (3R)-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]-3-[3-ethoxypropoxy-(3-fluorophenyl)methyl]piperidine-1-carboxamide |
| SMILES | CCOCCCOC(c1cccc(F)c1)[C@@H]1CCCN(C(=O)N[C@H](CNC)CC2CCCCC2)C1 |
| InChI | InChI=1S/C28H46FN3O3/c1-3-34-16-9-17-35-27(23-12-7-14-25(29)19-23)24-13-8-15-32(21-24)28(33)31-26(20-30-2)18-22-10-5-4-6-11-22/h7,12,14,19,22,24,26-27,30H,3-6,8-11,13,15-18,20-21H2,1-2H3,(H,31,33)/t24-,26+,27?/m1/s1 |
| InChIKey | GMVLYJRDYOHGSO-MFHGLKJTSA-N |
| XLogP | 5.29 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.69 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|