C28H40N2O3 — CID 67190776
N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]-3-[2-ethoxyethoxy(phenyl)methyl]benzamide (PubChem CID 67190776) has the molecular formula C28H40N2O3 and a molecular weight of 452.64 g/mol. Its IUPAC name is N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]-3-[2-ethoxyethoxy(phenyl)methyl]benzamide.
| Compound Name | N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]-3-[2-ethoxyethoxy(phenyl)methyl]benzamide |
|---|---|
| PubChem CID | 67190776 |
| Molecular Formula | C28H40N2O3 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.30 |
| IUPAC Name | N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]-3-[2-ethoxyethoxy(phenyl)methyl]benzamide |
| SMILES | CCOCCOC(c1ccccc1)c1cccc(C(=O)N[C@H](CNC)CC2CCCCC2)c1 |
| InChI | InChI=1S/C28H40N2O3/c1-3-32-17-18-33-27(23-13-8-5-9-14-23)24-15-10-16-25(20-24)28(31)30-26(21-29-2)19-22-11-6-4-7-12-22/h5,8-10,13-16,20,22,26-27,29H,3-4,6-7,11-12,17-19,21H2,1-2H3,(H,30,31)/t26-,27?/m0/s1 |
| InChIKey | QASUSJOOFFMMDE-QBHOUYDASA-N |
| XLogP | 5.12 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|