C26H34ClN3O5 — CID 25183940
2-[(R)-(3-chlorophenyl)-[3-[[(2S)-1-(methylamino)-3-(oxan-4-yl)propan-2-yl]carbamoyl]phenyl]methoxy]ethylcarbamic acid (PubChem CID 25183940) has the molecular formula C26H34ClN3O5 and a molecular weight of 504.03 g/mol. Its IUPAC name is 2-[(R)-(3-chlorophenyl)-[3-[[(2S)-1-(methylamino)-3-(oxan-4-yl)propan-2-yl]carbamoyl]phenyl]methoxy]ethylcarbamic acid.
| Compound Name | 2-[(R)-(3-chlorophenyl)-[3-[[(2S)-1-(methylamino)-3-(oxan-4-yl)propan-2-yl]carbamoyl]phenyl]methoxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 25183940 |
| Molecular Formula | C26H34ClN3O5 |
| Molecular Weight | 504.03 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | 2-[(R)-(3-chlorophenyl)-[3-[[(2S)-1-(methylamino)-3-(oxan-4-yl)propan-2-yl]carbamoyl]phenyl]methoxy]ethylcarbamic acid |
| SMILES | CNC[C@H](CC1CCOCC1)NC(=O)c1cccc([C@@H](OCCNC(=O)O)c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C26H34ClN3O5/c1-28-17-23(14-18-8-11-34-12-9-18)30-25(31)21-6-2-4-19(15-21)24(35-13-10-29-26(32)33)20-5-3-7-22(27)16-20/h2-7,15-16,18,23-24,28-29H,8-14,17H2,1H3,(H,30,31)(H,32,33)/t23-,24+/m0/s1 |
| InChIKey | CCKKBJYPXGDGFA-BJKOFHAPSA-N |
| XLogP | 3.85 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.03 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|