C28H38ClN3O4 — CID 75068159
methyl N-[2-[(3-chlorophenyl)-[3-[[3-cyclohexyl-2-(methylamino)propyl]carbamoyl]phenyl]methoxy]ethyl]carbamate (PubChem CID 75068159) has the molecular formula C28H38ClN3O4 and a molecular weight of 516.08 g/mol. Its IUPAC name is methyl N-[2-[(3-chlorophenyl)-[3-[[3-cyclohexyl-2-(methylamino)propyl]carbamoyl]phenyl]methoxy]ethyl]carbamate.
| Compound Name | methyl N-[2-[(3-chlorophenyl)-[3-[[3-cyclohexyl-2-(methylamino)propyl]carbamoyl]phenyl]methoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 75068159 |
| Molecular Formula | C28H38ClN3O4 |
| Molecular Weight | 516.08 g/mol |
| Exact Mass | 515.26 |
| IUPAC Name | methyl N-[2-[(3-chlorophenyl)-[3-[[3-cyclohexyl-2-(methylamino)propyl]carbamoyl]phenyl]methoxy]ethyl]carbamate |
| SMILES | CNC(CNC(=O)c1cccc(C(OCCNC(=O)OC)c2cccc(Cl)c2)c1)CC1CCCCC1 |
| InChI | InChI=1S/C28H38ClN3O4/c1-30-25(16-20-8-4-3-5-9-20)19-32-27(33)23-12-6-10-21(17-23)26(22-11-7-13-24(29)18-22)36-15-14-31-28(34)35-2/h6-7,10-13,17-18,20,25-26,30H,3-5,8-9,14-16,19H2,1-2H3,(H,31,34)(H,32,33) |
| InChIKey | DJJPAKHOMFWRKP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.08 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|